C17H15ClN2O7 — CID 137467403
[(Z)-1-aminoethylideneamino] (2S)-7-chloro-1'-hydroxy-4-methoxy-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carboxylate (PubChem CID 137467403) has the molecular formula C17H15ClN2O7 and a molecular weight of 394.77 g/mol. Its IUPAC name is [(Z)-1-aminoethylideneamino] (2S)-7-chloro-1'-hydroxy-4-methoxy-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carboxylate.
| Compound Name | [(Z)-1-aminoethylideneamino] (2S)-7-chloro-1'-hydroxy-4-methoxy-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carboxylate |
|---|---|
| PubChem CID | 137467403 |
| Molecular Formula | C17H15ClN2O7 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | [(Z)-1-aminoethylideneamino] (2S)-7-chloro-1'-hydroxy-4-methoxy-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carboxylate |
| SMILES | COc1cc(C(=O)O/N=C(/C)N)c(Cl)c2c1C(=O)[C@@]1(CCC(=O)C=C1O)O2 |
| InChI | InChI=1S/C17H15ClN2O7/c1-7(19)20-27-16(24)9-6-10(25-2)12-14(13(9)18)26-17(15(12)23)4-3-8(21)5-11(17)22/h5-6,22H,3-4H2,1-2H3,(H2,19,20)/t17-/m0/s1 |
| InChIKey | NTYWKRWZOFUOEB-KRWDZBQOSA-N |
| XLogP | 1.92 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|