C24H21Cl2FN6O5 — CID 142552289
(2R,4R,5R,6S)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-6-[2-(5-chloro-2-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]-5-hydroxy-2-(hydroxymethyl)oxan-3-one (PubChem CID 142552289) has the molecular formula C24H21Cl2FN6O5 and a molecular weight of 563.37 g/mol. Its IUPAC name is (2R,4R,5R,6S)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-6-[2-(5-chloro-2-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]-5-hydroxy-2-(hydroxymethyl)oxan-3-one.
| Compound Name | (2R,4R,5R,6S)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-6-[2-(5-chloro-2-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]-5-hydroxy-2-(hydroxymethyl)oxan-3-one |
|---|---|
| PubChem CID | 142552289 |
| Molecular Formula | C24H21Cl2FN6O5 |
| Molecular Weight | 563.37 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | (2R,4R,5R,6S)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-6-[2-(5-chloro-2-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]-5-hydroxy-2-(hydroxymethyl)oxan-3-one |
| SMILES | COc1ccc(Cl)cc1-n1nc(C)nc1[C@@H]1O[C@H](CO)C(=O)[C@H](n2cc(-c3ccc(Cl)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C24H21Cl2FN6O5/c1-11-28-24(33(30-11)17-8-13(25)4-6-18(17)37-2)23-22(36)20(21(35)19(10-34)38-23)32-9-16(29-31-32)12-3-5-14(26)15(27)7-12/h3-9,19-20,22-23,34,36H,10H2,1-2H3/t19-,20+,22-,23-/m1/s1 |
| InChIKey | CUABVYIBRPATSR-IRMYBRCSSA-N |
| XLogP | 2.89 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |