About N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane
N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane (PubChem CID 142554408) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane.
Molecular Properties
| Compound Name | N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane |
| PubChem CID | 142554408 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane |
| SMILES | CC.CC/C=C\N/C(C)=N/C |
| InChI | InChI=1S/C7H14N2.C2H6/c1-4-5-6-9-7(2)8-3;1-2/h5-6H,4H2,1-3H3,(H,8,9);1-2H3/b6-5-; |
| InChIKey | ISMNSMHHDOJXCH-YSMBQZINSA-N |
| XLogP | 2.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane?
The IUPAC name of N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane (CID 142554408) is N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane.
What is the SMILES notation for N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane?
The canonical SMILES for N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane is CC.CC/C=C\N/C(C)=N/C.
What is the InChIKey of N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane?
The InChIKey is ISMNSMHHDOJXCH-YSMBQZINSA-N. The full InChI is InChI=1S/C7H14N2.C2H6/c1-4-5-6-9-7(2)8-3;1-2/h5-6H,4H2,1-3H3,(H,8,9);1-2H3/b6-5-;.
What are the key properties of N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane?
N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane has a molecular weight of 156.27 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-1-enyl]-N'-methylethanimidamide;ethane is sourced from PubChem (CID 142554408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).