C10H11ClN4 — CID 142556800
4-chloro-6-[(3R)-3-ethynylpiperazin-1-yl]pyrimidine (PubChem CID 142556800) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 4-chloro-6-[(3R)-3-ethynylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-chloro-6-[(3R)-3-ethynylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 142556800 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 4-chloro-6-[(3R)-3-ethynylpiperazin-1-yl]pyrimidine |
| SMILES | C#C[C@@H]1CN(c2cc(Cl)ncn2)CCN1 |
| InChI | InChI=1S/C10H11ClN4/c1-2-8-6-15(4-3-12-8)10-5-9(11)13-7-14-10/h1,5,7-8,12H,3-4,6H2/t8-/m1/s1 |
| InChIKey | JHKPUFRYZZFOTA-MRVPVSSYSA-N |
| XLogP | 0.54 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|