C26H44N2O — CID 142559611
(E)-N-(aminomethyl)-6-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-2-enamide (PubChem CID 142559611) has the molecular formula C26H44N2O and a molecular weight of 400.65 g/mol. Its IUPAC name is (E)-N-(aminomethyl)-6-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-2-enamide.
| Compound Name | (E)-N-(aminomethyl)-6-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-2-enamide |
|---|---|
| PubChem CID | 142559611 |
| Molecular Formula | C26H44N2O |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.35 |
| IUPAC Name | (E)-N-(aminomethyl)-6-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-2-enamide |
| SMILES | CC12CCCCC1CCC1C2CCC2(C)C(CCC/C=C/C(=O)NCN)CCC12 |
| InChI | InChI=1S/C26H44N2O/c1-25-16-7-6-9-19(25)11-13-21-22-14-12-20(26(22,2)17-15-23(21)25)8-4-3-5-10-24(29)28-18-27/h5,10,19-23H,3-4,6-9,11-18,27H2,1-2H3,(H,28,29)/b10-5+ |
| InChIKey | KDJSADITNAINCB-BJMVGYQFSA-N |
| XLogP | 5.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|