C27H48N2O3 — CID 142559626
(E)-N-(aminomethyl)-6-(6,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-2-enamide;methane (PubChem CID 142559626) has the molecular formula C27H48N2O3 and a molecular weight of 448.69 g/mol. Its IUPAC name is (E)-N-(aminomethyl)-6-(6,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-2-enamide;methane.
| Compound Name | (E)-N-(aminomethyl)-6-(6,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-2-enamide;methane |
|---|---|
| PubChem CID | 142559626 |
| Molecular Formula | C27H48N2O3 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.37 |
| IUPAC Name | (E)-N-(aminomethyl)-6-(6,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-2-enamide;methane |
| SMILES | C.CC12CCC3C(C(O)C(O)C4CCCCC43C)C1CCC2CCC/C=C/C(=O)NCN |
| InChI | InChI=1S/C26H44N2O3.CH4/c1-25-15-13-19-22(24(31)23(30)20-9-6-7-14-26(19,20)2)18(25)12-11-17(25)8-4-3-5-10-21(29)28-16-27;/h5,10,17-20,22-24,30-31H,3-4,6-9,11-16,27H2,1-2H3,(H,28,29);1H4/b10-5+; |
| InChIKey | OKDBCWNYIYDSQG-OAZHBLANSA-N |
| XLogP | 4.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|