C29H49N3O5 — CID 142559730
(E)-N-(1-acetamido-2-aminoethyl)-6-(3,6,7-trihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)hept-2-enamide (PubChem CID 142559730) has the molecular formula C29H49N3O5 and a molecular weight of 519.73 g/mol. Its IUPAC name is (E)-N-(1-acetamido-2-aminoethyl)-6-(3,6,7-trihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)hept-2-enamide.
| Compound Name | (E)-N-(1-acetamido-2-aminoethyl)-6-(3,6,7-trihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)hept-2-enamide |
|---|---|
| PubChem CID | 142559730 |
| Molecular Formula | C29H49N3O5 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.37 |
| IUPAC Name | (E)-N-(1-acetamido-2-aminoethyl)-6-(3,6,7-trihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)hept-2-enamide |
| SMILES | CC(=O)NC(CN)NC(=O)/C=C/CCC(C)C1CCC2C1CCC1C2C(O)C(O)C2CC(O)CCC21C |
| InChI | InChI=1S/C29H49N3O5/c1-16(6-4-5-7-25(35)32-24(15-30)31-17(2)33)19-8-9-21-20(19)10-11-22-26(21)28(37)27(36)23-14-18(34)12-13-29(22,23)3/h5,7,16,18-24,26-28,34,36-37H,4,6,8-15,30H2,1-3H3,(H,31,33)(H,32,35)/b7-5+ |
| InChIKey | XJDTWYCRTZIOQF-FNORWQNLSA-N |
| XLogP | 2.07 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|