C15H27N — CID 142560264
2,3,3,5,5,8-hexamethylnona-1,7-dien-4-imine (PubChem CID 142560264) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 2,3,3,5,5,8-hexamethylnona-1,7-dien-4-imine.
| Compound Name | 2,3,3,5,5,8-hexamethylnona-1,7-dien-4-imine |
|---|---|
| PubChem CID | 142560264 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2,3,3,5,5,8-hexamethylnona-1,7-dien-4-imine |
| SMILES | [H]/N=C(\C(C)(C)CC=C(C)C)C(C)(C)C(=C)C |
| InChI | InChI=1S/C15H27N/c1-11(2)9-10-14(5,6)13(16)15(7,8)12(3)4/h9,16H,3,10H2,1-2,4-8H3/b16-13+ |
| InChIKey | DLZIIRANRAXJIS-DTQAZKPQSA-N |
| XLogP | 4.99 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|