C12H23N — CID 142560268
5-ethyl-2,3,3-trimethylhept-1-en-4-imine (PubChem CID 142560268) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 5-ethyl-2,3,3-trimethylhept-1-en-4-imine.
| Compound Name | 5-ethyl-2,3,3-trimethylhept-1-en-4-imine |
|---|---|
| PubChem CID | 142560268 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 5-ethyl-2,3,3-trimethylhept-1-en-4-imine |
| SMILES | [H]/N=C(\C(CC)CC)C(C)(C)C(=C)C |
| InChI | InChI=1S/C12H23N/c1-7-10(8-2)11(13)12(5,6)9(3)4/h10,13H,3,7-8H2,1-2,4-6H3/b13-11+ |
| InChIKey | KDMOBGMVWWNLON-ACCUITESSA-N |
| XLogP | 4.04 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|