C15H29N — CID 123178237
3,6-diethyl-3,6-dimethyl-5-methylideneoctan-4-imine (PubChem CID 123178237) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 3,6-diethyl-3,6-dimethyl-5-methylideneoctan-4-imine.
| Compound Name | 3,6-diethyl-3,6-dimethyl-5-methylideneoctan-4-imine |
|---|---|
| PubChem CID | 123178237 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 3,6-diethyl-3,6-dimethyl-5-methylideneoctan-4-imine |
| SMILES | [H]/N=C(\C(=C)C(C)(CC)CC)C(C)(CC)CC |
| InChI | InChI=1S/C15H29N/c1-8-14(6,9-2)12(5)13(16)15(7,10-3)11-4/h16H,5,8-11H2,1-4,6-7H3/b16-13+ |
| InChIKey | ACQBYQGBPMALOU-DTQAZKPQSA-N |
| XLogP | 5.21 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|