About 2,2,4-trimethylhepta-4,5-dien-3-imine
2,2,4-trimethylhepta-4,5-dien-3-imine (PubChem CID 89244188) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 2,2,4-trimethylhepta-4,5-dien-3-imine.
Molecular Properties
| Compound Name | 2,2,4-trimethylhepta-4,5-dien-3-imine |
| PubChem CID | 89244188 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2,2,4-trimethylhepta-4,5-dien-3-imine |
| SMILES | [H]/N=C(\C(C)=C=CC)C(C)(C)C |
| InChI | InChI=1S/C10H17N/c1-6-7-8(2)9(11)10(3,4)5/h6,11H,1-5H3/b11-9+ |
| InChIKey | BIQRJIQHFZCZTK-PKNBQFBNSA-N |
| XLogP | 3.17 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2,4-trimethylhepta-4,5-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,4-trimethylhepta-4,5-dien-3-imine?
The IUPAC name of 2,2,4-trimethylhepta-4,5-dien-3-imine (CID 89244188) is 2,2,4-trimethylhepta-4,5-dien-3-imine.
What is the SMILES notation for 2,2,4-trimethylhepta-4,5-dien-3-imine?
The canonical SMILES for 2,2,4-trimethylhepta-4,5-dien-3-imine is [H]/N=C(\C(C)=C=CC)C(C)(C)C.
What is the InChIKey of 2,2,4-trimethylhepta-4,5-dien-3-imine?
The InChIKey is BIQRJIQHFZCZTK-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H17N/c1-6-7-8(2)9(11)10(3,4)5/h6,11H,1-5H3/b11-9+.
What are the key properties of 2,2,4-trimethylhepta-4,5-dien-3-imine?
2,2,4-trimethylhepta-4,5-dien-3-imine has a molecular weight of 151.25 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4-trimethylhepta-4,5-dien-3-imine is sourced from PubChem (CID 89244188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).