C17H30O4 — CID 14256164
(5R)-5-[(4S,5R)-2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl]oxolan-2-one (PubChem CID 14256164) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is (5R)-5-[(4S,5R)-2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl]oxolan-2-one.
| Compound Name | (5R)-5-[(4S,5R)-2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl]oxolan-2-one |
|---|---|
| PubChem CID | 14256164 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (5R)-5-[(4S,5R)-2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl]oxolan-2-one |
| SMILES | CCCCCCCC[C@H]1OC(C)(C)O[C@@H]1[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C17H30O4/c1-4-5-6-7-8-9-10-14-16(21-17(2,3)20-14)13-11-12-15(18)19-13/h13-14,16H,4-12H2,1-3H3/t13-,14-,16-/m1/s1 |
| InChIKey | QYQSZYLQNQVFII-IIAWOOMASA-N |
| XLogP | 3.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|