C27H41N3O2 — CID 142563028
6-(5-methylfuran-2-yl)-N-[[4-(pentylamino)cyclohexyl]methoxymethyl]isoquinolin-3-amine;molecular hydrogen (PubChem CID 142563028) has the molecular formula C27H41N3O2 and a molecular weight of 439.64 g/mol. Its IUPAC name is 6-(5-methylfuran-2-yl)-N-[[4-(pentylamino)cyclohexyl]methoxymethyl]isoquinolin-3-amine;molecular hydrogen.
| Compound Name | 6-(5-methylfuran-2-yl)-N-[[4-(pentylamino)cyclohexyl]methoxymethyl]isoquinolin-3-amine;molecular hydrogen |
|---|---|
| PubChem CID | 142563028 |
| Molecular Formula | C27H41N3O2 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | 6-(5-methylfuran-2-yl)-N-[[4-(pentylamino)cyclohexyl]methoxymethyl]isoquinolin-3-amine;molecular hydrogen |
| SMILES | CCCCCNC1CCC(COCNc2cc3cc(-c4ccc(C)o4)ccc3cn2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C27H37N3O2.2H2/c1-3-4-5-14-28-25-11-7-21(8-12-25)18-31-19-30-27-16-24-15-22(9-10-23(24)17-29-27)26-13-6-20(2)32-26;;/h6,9-10,13,15-17,21,25,28H,3-5,7-8,11-12,14,18-19H2,1-2H3,(H,29,30);2*1H |
| InChIKey | RFKYDYIAWLXWGL-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|