C26H24ClF3N8O4 — CID 142564460
2-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-[1-(1,2-oxazol-3-yl)ethyl]benzamide (PubChem CID 142564460) has the molecular formula C26H24ClF3N8O4 and a molecular weight of 604.98 g/mol. Its IUPAC name is 2-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-[1-(1,2-oxazol-3-yl)ethyl]benzamide.
| Compound Name | 2-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-[1-(1,2-oxazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 142564460 |
| Molecular Formula | C26H24ClF3N8O4 |
| Molecular Weight | 604.98 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 2-[3-[[[(4-chlorobenzenecarboximidoyl)-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]carbamoyl]amino]methyl]-1,2,4-triazol-1-yl]-N-[1-(1,2-oxazol-3-yl)ethyl]benzamide |
| SMILES | [H]/N=C(\c1ccc(Cl)cc1)N(C[C@H](O)C(F)(F)F)C(=O)NCc1ncn(-c2ccccc2C(=O)NC(C)c2ccon2)n1 |
| InChI | InChI=1S/C26H24ClF3N8O4/c1-15(19-10-11-42-36-19)34-24(40)18-4-2-3-5-20(18)38-14-33-22(35-38)12-32-25(41)37(13-21(39)26(28,29)30)23(31)16-6-8-17(27)9-7-16/h2-11,14-15,21,31,39H,12-13H2,1H3,(H,32,41)(H,34,40)/b31-23+/t15?,21-/m0/s1 |
| InChIKey | SHWACJSDQJGGNQ-HNVDPPGISA-N |
| XLogP | 3.86 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.98 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|