C26H35N3O3 — CID 142572689
tert-butyl 2-[4-methyl-5-oxo-4-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate;ethene (PubChem CID 142572689) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is tert-butyl 2-[4-methyl-5-oxo-4-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate;ethene.
| Compound Name | tert-butyl 2-[4-methyl-5-oxo-4-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate;ethene |
|---|---|
| PubChem CID | 142572689 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | tert-butyl 2-[4-methyl-5-oxo-4-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate;ethene |
| SMILES | C=C.C=C/C(=C\C)c1ccc(C2(C)N=C(C3CCCN3C(=O)OC(C)(C)C)NC2=O)cc1 |
| InChI | InChI=1S/C24H31N3O3.C2H4/c1-7-16(8-2)17-11-13-18(14-12-17)24(6)21(28)25-20(26-24)19-10-9-15-27(19)22(29)30-23(3,4)5;1-2/h7-8,11-14,19H,1,9-10,15H2,2-6H3,(H,25,26,28);1-2H2/b16-8+; |
| InChIKey | AUQWUQVUGWDWKZ-OHGISNTKSA-N |
| XLogP | 5.22 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|