C21H28N4O — CID 142572617
ethane;4-methyl-4-[4-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]phenyl]-2-pyrrolidin-2-yl-1H-imidazol-5-one (PubChem CID 142572617) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is ethane;4-methyl-4-[4-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]phenyl]-2-pyrrolidin-2-yl-1H-imidazol-5-one.
| Compound Name | ethane;4-methyl-4-[4-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]phenyl]-2-pyrrolidin-2-yl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 142572617 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | ethane;4-methyl-4-[4-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]phenyl]-2-pyrrolidin-2-yl-1H-imidazol-5-one |
| SMILES | C=C/C(=C\N=C)c1ccc(C2(C)N=C(C3CCCN3)NC2=O)cc1.CC |
| InChI | InChI=1S/C19H22N4O.C2H6/c1-4-13(12-20-3)14-7-9-15(10-8-14)19(2)18(24)22-17(23-19)16-6-5-11-21-16;1-2/h4,7-10,12,16,21H,1,3,5-6,11H2,2H3,(H,22,23,24);1-2H3/b13-12+; |
| InChIKey | HWCICNPBGIPDJZ-UEIGIMKUSA-N |
| XLogP | 3.44 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|