About propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate
propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate (PubChem CID 142573388) has the molecular formula C13H19N3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate.
Molecular Properties
| Compound Name | propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate |
| PubChem CID | 142573388 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate |
| SMILES | C=N/N=C(/SCCC)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H19N3S/c1-4-10-17-13(15-14-2)16(3)11-12-8-6-5-7-9-12/h5-9H,2,4,10-11H2,1,3H3/b15-13+ |
| InChIKey | UUVOSQCKFNJVOT-FYWRMAATSA-N |
| XLogP | 3.23 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate?
The IUPAC name of propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate (CID 142573388) is propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate.
What is the SMILES notation for propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate?
The canonical SMILES for propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate is C=N/N=C(/SCCC)N(C)Cc1ccccc1.
What is the InChIKey of propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate?
The InChIKey is UUVOSQCKFNJVOT-FYWRMAATSA-N. The full InChI is InChI=1S/C13H19N3S/c1-4-10-17-13(15-14-2)16(3)11-12-8-6-5-7-9-12/h5-9H,2,4,10-11H2,1,3H3/b15-13+.
What are the key properties of propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate?
propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate has a molecular weight of 249.38 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-benzyl-N-methyl-N'-(methylideneamino)carbamimidothioate is sourced from PubChem (CID 142573388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).