C16H10Cl2F3NO2 — CID 142574576
methyl 3-chloro-6-[2-chloro-3-ethenyl-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate (PubChem CID 142574576) has the molecular formula C16H10Cl2F3NO2 and a molecular weight of 376.16 g/mol. Its IUPAC name is methyl 3-chloro-6-[2-chloro-3-ethenyl-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[2-chloro-3-ethenyl-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142574576 |
| Molecular Formula | C16H10Cl2F3NO2 |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | methyl 3-chloro-6-[2-chloro-3-ethenyl-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
| SMILES | C=Cc1c(C(F)(F)F)ccc(-c2ccc(Cl)c(C(=O)OC)n2)c1Cl |
| InChI | InChI=1S/C16H10Cl2F3NO2/c1-3-8-10(16(19,20)21)5-4-9(13(8)18)12-7-6-11(17)14(22-12)15(23)24-2/h3-7H,1H2,2H3 |
| InChIKey | RRRBXRGSAJCZAW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |