C21H24N2O2S — CID 14257642
methyl (E)-3-[10-[2-(dimethylamino)propyl]phenothiazin-3-yl]prop-2-enoate (PubChem CID 14257642) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is methyl (E)-3-[10-[2-(dimethylamino)propyl]phenothiazin-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[10-[2-(dimethylamino)propyl]phenothiazin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 14257642 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl (E)-3-[10-[2-(dimethylamino)propyl]phenothiazin-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)Sc1ccccc1N2CC(C)N(C)C |
| InChI | InChI=1S/C21H24N2O2S/c1-15(22(2)3)14-23-17-7-5-6-8-19(17)26-20-13-16(9-11-18(20)23)10-12-21(24)25-4/h5-13,15H,14H2,1-4H3/b12-10+ |
| InChIKey | SFZWXXCAXDLHPK-ZRDIBKRKSA-N |
| XLogP | 4.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|