C10H15N3O3PS- — CID 142588334
N-[(1S,3R)-3-[[hydroxy(oxido)phosphinothioyl]oxymethyl]cyclopentyl]pyrimidin-4-amine (PubChem CID 142588334) has the molecular formula C10H15N3O3PS- and a molecular weight of 288.29 g/mol. Its IUPAC name is N-[(1S,3R)-3-[[hydroxy(oxido)phosphinothioyl]oxymethyl]cyclopentyl]pyrimidin-4-amine.
| Compound Name | N-[(1S,3R)-3-[[hydroxy(oxido)phosphinothioyl]oxymethyl]cyclopentyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142588334 |
| Molecular Formula | C10H15N3O3PS- |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-[(1S,3R)-3-[[hydroxy(oxido)phosphinothioyl]oxymethyl]cyclopentyl]pyrimidin-4-amine |
| SMILES | [O-]P(O)(=S)OC[C@@H]1CC[C@H](Nc2ccncn2)C1 |
| InChI | InChI=1S/C10H16N3O3PS/c14-17(15,18)16-6-8-1-2-9(5-8)13-10-3-4-11-7-12-10/h3-4,7-9H,1-2,5-6H2,(H,11,12,13)(H2,14,15,18)/p-1/t8-,9+/m1/s1 |
| InChIKey | XESDDDYIFXUXLS-BDAKNGLRSA-M |
| XLogP | 0.65 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|