C31H50N10 — CID 142588363
N-[[4-(diethylamino)phenyl]methyl]-6-(4-ethylpiperazin-1-yl)-9-[3-(4-ethylpiperazin-1-yl)propyl]purin-2-amine (PubChem CID 142588363) has the molecular formula C31H50N10 and a molecular weight of 562.81 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-6-(4-ethylpiperazin-1-yl)-9-[3-(4-ethylpiperazin-1-yl)propyl]purin-2-amine.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-6-(4-ethylpiperazin-1-yl)-9-[3-(4-ethylpiperazin-1-yl)propyl]purin-2-amine |
|---|---|
| PubChem CID | 142588363 |
| Molecular Formula | C31H50N10 |
| Molecular Weight | 562.81 g/mol |
| Exact Mass | 562.42 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-6-(4-ethylpiperazin-1-yl)-9-[3-(4-ethylpiperazin-1-yl)propyl]purin-2-amine |
| SMILES | CCN1CCN(CCCn2cnc3c(N4CCN(CC)CC4)nc(NCc4ccc(N(CC)CC)cc4)nc32)CC1 |
| InChI | InChI=1S/C31H50N10/c1-5-36-16-18-38(19-17-36)14-9-15-41-25-33-28-29(40-22-20-37(6-2)21-23-40)34-31(35-30(28)41)32-24-26-10-12-27(13-11-26)39(7-3)8-4/h10-13,25H,5-9,14-24H2,1-4H3,(H,32,34,35) |
| InChIKey | NSRJPHPTKYQXQV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|