C23H39N9 — CID 149302414
6-(4-cyclopentylpiperazin-1-yl)-9-[3-(4-ethylpiperazin-1-yl)propyl]purin-2-amine (PubChem CID 149302414) has the molecular formula C23H39N9 and a molecular weight of 441.63 g/mol. Its IUPAC name is 6-(4-cyclopentylpiperazin-1-yl)-9-[3-(4-ethylpiperazin-1-yl)propyl]purin-2-amine.
| Compound Name | 6-(4-cyclopentylpiperazin-1-yl)-9-[3-(4-ethylpiperazin-1-yl)propyl]purin-2-amine |
|---|---|
| PubChem CID | 149302414 |
| Molecular Formula | C23H39N9 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.33 |
| IUPAC Name | 6-(4-cyclopentylpiperazin-1-yl)-9-[3-(4-ethylpiperazin-1-yl)propyl]purin-2-amine |
| SMILES | CCN1CCN(CCCn2cnc3c(N4CCN(C5CCCC5)CC4)nc(N)nc32)CC1 |
| InChI | InChI=1S/C23H39N9/c1-2-28-10-12-29(13-11-28)8-5-9-32-18-25-20-21(26-23(24)27-22(20)32)31-16-14-30(15-17-31)19-6-3-4-7-19/h18-19H,2-17H2,1H3,(H2,24,26,27) |
| InChIKey | XXAGOPCOQGXRCQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |