C13H17NO — CID 142588473
2-[(2R)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]propan-2-ol (PubChem CID 142588473) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-[(2R)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]propan-2-ol.
| Compound Name | 2-[(2R)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 142588473 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-[(2R)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C13H17NO/c1-13(2,15)12-9-8-11(14-12)10-6-4-3-5-7-10/h3-7,12,15H,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | MLZGRSHSRSNHIS-GFCCVEGCSA-N |
| XLogP | 2.41 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |