C17H17FN2O2SSe — CID 142589364
(2E)-3-(4-fluorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide (PubChem CID 142589364) has the molecular formula C17H17FN2O2SSe and a molecular weight of 411.36 g/mol. Its IUPAC name is (2E)-3-(4-fluorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide.
| Compound Name | (2E)-3-(4-fluorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide |
|---|---|
| PubChem CID | 142589364 |
| Molecular Formula | C17H17FN2O2SSe |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | (2E)-3-(4-fluorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide |
| SMILES | O=C(NCC[Se]Sc1ccccc1)/C(Cc1ccc(F)cc1)=N/O |
| InChI | InChI=1S/C17H17FN2O2SSe/c18-14-8-6-13(7-9-14)12-16(20-22)17(21)19-10-11-24-23-15-4-2-1-3-5-15/h1-9,22H,10-12H2,(H,19,21)/b20-16+ |
| InChIKey | MDRYKVLZYCUAEU-CAPFRKAQSA-N |
| XLogP | 3.14 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|