C17H16F2N2O2SSe — CID 142589367
(2E)-3-(3,4-difluorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide (PubChem CID 142589367) has the molecular formula C17H16F2N2O2SSe and a molecular weight of 429.35 g/mol. Its IUPAC name is (2E)-3-(3,4-difluorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide.
| Compound Name | (2E)-3-(3,4-difluorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide |
|---|---|
| PubChem CID | 142589367 |
| Molecular Formula | C17H16F2N2O2SSe |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | (2E)-3-(3,4-difluorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide |
| SMILES | O=C(NCC[Se]Sc1ccccc1)/C(Cc1ccc(F)c(F)c1)=N/O |
| InChI | InChI=1S/C17H16F2N2O2SSe/c18-14-7-6-12(10-15(14)19)11-16(21-23)17(22)20-8-9-25-24-13-4-2-1-3-5-13/h1-7,10,23H,8-9,11H2,(H,20,22)/b21-16+ |
| InChIKey | WRSFQYNQUONQCJ-LTGZKZEYSA-N |
| XLogP | 3.28 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|