C28H37ClN4O3 — CID 142590549
(E)-3-(6-chloro-2-pyridinyl)-2-cyano-N-[3-[4-(2-morpholin-4-ylethoxy)phenyl]pentan-3-yl]prop-2-enamide;ethane (PubChem CID 142590549) has the molecular formula C28H37ClN4O3 and a molecular weight of 513.08 g/mol. Its IUPAC name is (E)-3-(6-chloro-2-pyridinyl)-2-cyano-N-[3-[4-(2-morpholin-4-ylethoxy)phenyl]pentan-3-yl]prop-2-enamide;ethane.
| Compound Name | (E)-3-(6-chloro-2-pyridinyl)-2-cyano-N-[3-[4-(2-morpholin-4-ylethoxy)phenyl]pentan-3-yl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 142590549 |
| Molecular Formula | C28H37ClN4O3 |
| Molecular Weight | 513.08 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | (E)-3-(6-chloro-2-pyridinyl)-2-cyano-N-[3-[4-(2-morpholin-4-ylethoxy)phenyl]pentan-3-yl]prop-2-enamide;ethane |
| SMILES | CC.CCC(CC)(NC(=O)/C(C#N)=C/c1cccc(Cl)n1)c1ccc(OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H31ClN4O3.C2H6/c1-3-26(4-2,30-25(32)20(19-28)18-22-6-5-7-24(27)29-22)21-8-10-23(11-9-21)34-17-14-31-12-15-33-16-13-31;1-2/h5-11,18H,3-4,12-17H2,1-2H3,(H,30,32);1-2H3/b20-18+; |
| InChIKey | YDNKYNAMAZAAIV-KPJFUTMLSA-N |
| XLogP | 5.21 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.08 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|