C29H38N4O3 — CID 160523382
(E)-2-cyano-N-[3-[4-[2-(2-piperidin-1-ylethoxy)ethoxy]phenyl]pentan-3-yl]-3-pyridin-2-ylprop-2-enamide (PubChem CID 160523382) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is (E)-2-cyano-N-[3-[4-[2-(2-piperidin-1-ylethoxy)ethoxy]phenyl]pentan-3-yl]-3-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[3-[4-[2-(2-piperidin-1-ylethoxy)ethoxy]phenyl]pentan-3-yl]-3-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 160523382 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (E)-2-cyano-N-[3-[4-[2-(2-piperidin-1-ylethoxy)ethoxy]phenyl]pentan-3-yl]-3-pyridin-2-ylprop-2-enamide |
| SMILES | CCC(CC)(NC(=O)/C(C#N)=C/c1ccccn1)c1ccc(OCCOCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C29H38N4O3/c1-3-29(4-2,32-28(34)24(23-30)22-26-10-6-7-15-31-26)25-11-13-27(14-12-25)36-21-20-35-19-18-33-16-8-5-9-17-33/h6-7,10-15,22H,3-5,8-9,16-21H2,1-2H3,(H,32,34)/b24-22+ |
| InChIKey | HYXOOIMEEUNQBM-ZNTNEXAZSA-N |
| XLogP | 4.70 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|