C27H28N6O3 — CID 142590855
[amino-[(2-oxo-5-phenyl-1,3-dihydro-1-benzazepin-3-yl)amino]methyl] 2-morpholin-4-ylpyridine-3-carboximidate (PubChem CID 142590855) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is [amino-[(2-oxo-5-phenyl-1,3-dihydro-1-benzazepin-3-yl)amino]methyl] 2-morpholin-4-ylpyridine-3-carboximidate.
| Compound Name | [amino-[(2-oxo-5-phenyl-1,3-dihydro-1-benzazepin-3-yl)amino]methyl] 2-morpholin-4-ylpyridine-3-carboximidate |
|---|---|
| PubChem CID | 142590855 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [amino-[(2-oxo-5-phenyl-1,3-dihydro-1-benzazepin-3-yl)amino]methyl] 2-morpholin-4-ylpyridine-3-carboximidate |
| SMILES | [H]/N=C(/OC(N)NC1C=C(c2ccccc2)c2ccccc2NC1=O)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C27H28N6O3/c28-24(20-10-6-12-30-25(20)33-13-15-35-16-14-33)36-27(29)32-23-17-21(18-7-2-1-3-8-18)19-9-4-5-11-22(19)31-26(23)34/h1-12,17,23,27-28,32H,13-16,29H2,(H,31,34)/b28-24+ |
| InChIKey | JQEMONXATBHOHY-ZZIIXHQDSA-N |
| XLogP | 2.54 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|