C27H27N7O3S — CID 145236569
amino 3-morpholin-4-ylthieno[2,3-b]pyridine-2-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 145236569) has the molecular formula C27H27N7O3S and a molecular weight of 529.63 g/mol. Its IUPAC name is amino 3-morpholin-4-ylthieno[2,3-b]pyridine-2-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | amino 3-morpholin-4-ylthieno[2,3-b]pyridine-2-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 145236569 |
| Molecular Formula | C27H27N7O3S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | amino 3-morpholin-4-ylthieno[2,3-b]pyridine-2-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | NC1N=C(c2ccccc2)c2ccccc2NC1=O.[H]/N=C(\ON)c1sc2ncccc2c1N1CCOCC1 |
| InChI | InChI=1S/C15H13N3O.C12H14N4O2S/c16-14-15(19)17-12-9-5-4-8-11(12)13(18-14)10-6-2-1-3-7-10;13-11(18-14)10-9(16-4-6-17-7-5-16)8-2-1-3-15-12(8)19-10/h1-9,14H,16H2,(H,17,19);1-3,13H,4-7,14H2/b;13-11- |
| InChIKey | BCGPEZMSGHPRED-KFPOVDHESA-N |
| XLogP | 3.11 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|