C20H18ClN5O3 — CID 145236457
amino 5-chlorofuran-2-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 145236457) has the molecular formula C20H18ClN5O3 and a molecular weight of 411.85 g/mol. Its IUPAC name is amino 5-chlorofuran-2-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | amino 5-chlorofuran-2-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 145236457 |
| Molecular Formula | C20H18ClN5O3 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | amino 5-chlorofuran-2-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | NC1N=C(c2ccccc2)c2ccccc2NC1=O.[H]/N=C(\ON)c1ccc(Cl)o1 |
| InChI | InChI=1S/C15H13N3O.C5H5ClN2O2/c16-14-15(19)17-12-9-5-4-8-11(12)13(18-14)10-6-2-1-3-7-10;6-4-2-1-3(9-4)5(7)10-8/h1-9,14H,16H2,(H,17,19);1-2,7H,8H2/b;7-5- |
| InChIKey | KYFVFNPADQTVIX-GMLUHMIMSA-N |
| XLogP | 2.91 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|