C19H18N6O2S — CID 145236685
3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;amino 1,3-thiazole-4-carboximidate (PubChem CID 145236685) has the molecular formula C19H18N6O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;amino 1,3-thiazole-4-carboximidate.
| Compound Name | 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;amino 1,3-thiazole-4-carboximidate |
|---|---|
| PubChem CID | 145236685 |
| Molecular Formula | C19H18N6O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;amino 1,3-thiazole-4-carboximidate |
| SMILES | NC1N=C(c2ccccc2)c2ccccc2NC1=O.[H]/N=C(\ON)c1cscn1 |
| InChI | InChI=1S/C15H13N3O.C4H5N3OS/c16-14-15(19)17-12-9-5-4-8-11(12)13(18-14)10-6-2-1-3-7-10;5-4(8-6)3-1-9-2-7-3/h1-9,14H,16H2,(H,17,19);1-2,5H,6H2/b;5-4- |
| InChIKey | KXEVKVYSYXFSCE-GUHKXDMSSA-N |
| XLogP | 2.12 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|