C28H30F3N7O3S — CID 142552741
amino 5-[(3R)-3-methylmorpholin-4-yl]-2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-4-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 142552741) has the molecular formula C28H30F3N7O3S and a molecular weight of 601.66 g/mol. Its IUPAC name is amino 5-[(3R)-3-methylmorpholin-4-yl]-2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-4-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | amino 5-[(3R)-3-methylmorpholin-4-yl]-2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-4-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 142552741 |
| Molecular Formula | C28H30F3N7O3S |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | amino 5-[(3R)-3-methylmorpholin-4-yl]-2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-4-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | NC1N=C(c2ccccc2)c2ccccc2NC1=O.[H]/N=C(\ON)c1nc(C2(C(F)(F)F)CC2)sc1N1CCOC[C@H]1C |
| InChI | InChI=1S/C15H13N3O.C13H17F3N4O2S/c16-14-15(19)17-12-9-5-4-8-11(12)13(18-14)10-6-2-1-3-7-10;1-7-6-21-5-4-20(7)10-8(9(17)22-18)19-11(23-10)12(2-3-12)13(14,15)16/h1-9,14H,16H2,(H,17,19);7,17H,2-6,18H2,1H3/b;17-9-/t;7-/m.1/s1 |
| InChIKey | LULKTPRYTOQWSK-QTMCFGDDSA-N |
| XLogP | 3.94 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|