C23H26N6O3S — CID 145236526
amino 2-(2-methoxyethylamino)thiophene-3-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 145236526) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is amino 2-(2-methoxyethylamino)thiophene-3-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | amino 2-(2-methoxyethylamino)thiophene-3-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 145236526 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | amino 2-(2-methoxyethylamino)thiophene-3-carboximidate;3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | NC1N=C(c2ccccc2)c2ccccc2NC1=O.[H]/N=C(\ON)c1ccsc1NCCOC |
| InChI | InChI=1S/C15H13N3O.C8H13N3O2S/c16-14-15(19)17-12-9-5-4-8-11(12)13(18-14)10-6-2-1-3-7-10;1-12-4-3-11-8-6(2-5-14-8)7(9)13-10/h1-9,14H,16H2,(H,17,19);2,5,9,11H,3-4,10H2,1H3/b;9-7- |
| InChIKey | MNKSYZOIFVVBNB-QFWHIOIXSA-N |
| XLogP | 2.78 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|