C20H24N2O3S — CID 142592152
4-[2-(3-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-yl]-1,4-oxazepane (PubChem CID 142592152) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-[2-(3-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-yl]-1,4-oxazepane.
| Compound Name | 4-[2-(3-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-yl]-1,4-oxazepane |
|---|---|
| PubChem CID | 142592152 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[2-(3-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-yl]-1,4-oxazepane |
| SMILES | Cc1cccc(S(=O)(=O)N2Cc3cccc(N4CCCOCC4)c3C2)c1 |
| InChI | InChI=1S/C20H24N2O3S/c1-16-5-2-7-18(13-16)26(23,24)22-14-17-6-3-8-20(19(17)15-22)21-9-4-11-25-12-10-21/h2-3,5-8,13H,4,9-12,14-15H2,1H3 |
| InChIKey | CYSGBABALZNVGU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |