About N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide
N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide (PubChem CID 142592248) has the molecular formula C16H26N2O3
and a molecular weight of 294.40 g/mol. Its IUPAC name is N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide.
Molecular Properties
| Compound Name | N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide |
| PubChem CID | 142592248 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide |
| SMILES | CCOC1(CC)C=CC(C(C)(C)C)=CC1NC(=O)C(N)=O |
| InChI | InChI=1S/C16H26N2O3/c1-6-16(21-7-2)9-8-11(15(3,4)5)10-12(16)18-14(20)13(17)19/h8-10,12H,6-7H2,1-5H3,(H2,17,19)(H,18,20) |
| InChIKey | UELBIMNWAJUTCA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide?
The IUPAC name of N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide (CID 142592248) is N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide.
What is the SMILES notation for N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide?
The canonical SMILES for N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide is CCOC1(CC)C=CC(C(C)(C)C)=CC1NC(=O)C(N)=O.
What is the InChIKey of N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide?
The InChIKey is UELBIMNWAJUTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3/c1-6-16(21-7-2)9-8-11(15(3,4)5)10-12(16)18-14(20)13(17)19/h8-10,12H,6-7H2,1-5H3,(H2,17,19)(H,18,20).
What are the key properties of N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide?
N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide has a molecular weight of 294.40 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide is sourced from PubChem (CID 142592248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).