C22H32N2O4 — CID 152567326
N,N'-bis(6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide (PubChem CID 152567326) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is N,N'-bis(6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide.
| Compound Name | N,N'-bis(6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide |
|---|---|
| PubChem CID | 152567326 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N,N'-bis(6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide |
| SMILES | CCOC1(CC)C=CC=CC1NC(=O)C(=O)NC1C=CC=CC1(CC)OCC |
| InChI | InChI=1S/C22H32N2O4/c1-5-21(27-7-3)15-11-9-13-17(21)23-19(25)20(26)24-18-14-10-12-16-22(18,6-2)28-8-4/h9-18H,5-8H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | YQTBYLLMAQOIIY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|