C30H48N2O4 — CID 151250063
N,N'-bis(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide (PubChem CID 151250063) has the molecular formula C30H48N2O4 and a molecular weight of 500.72 g/mol. Its IUPAC name is N,N'-bis(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide.
| Compound Name | N,N'-bis(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide |
|---|---|
| PubChem CID | 151250063 |
| Molecular Formula | C30H48N2O4 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.36 |
| IUPAC Name | N,N'-bis(3-tert-butyl-6-ethoxy-6-ethylcyclohexa-2,4-dien-1-yl)oxamide |
| SMILES | CCOC1(CC)C=CC(C(C)(C)C)=CC1NC(=O)C(=O)NC1C=C(C(C)(C)C)C=CC1(CC)OCC |
| InChI | InChI=1S/C30H48N2O4/c1-11-29(35-13-3)17-15-21(27(5,6)7)19-23(29)31-25(33)26(34)32-24-20-22(28(8,9)10)16-18-30(24,12-2)36-14-4/h15-20,23-24H,11-14H2,1-10H3,(H,31,33)(H,32,34) |
| InChIKey | NSDAYWWGFGMDSP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|