C14H23NO2 — CID 142122290
N-(5,6-dimethyl-6-propoxycyclohexa-2,4-dien-1-yl)propanamide (PubChem CID 142122290) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-(5,6-dimethyl-6-propoxycyclohexa-2,4-dien-1-yl)propanamide.
| Compound Name | N-(5,6-dimethyl-6-propoxycyclohexa-2,4-dien-1-yl)propanamide |
|---|---|
| PubChem CID | 142122290 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-(5,6-dimethyl-6-propoxycyclohexa-2,4-dien-1-yl)propanamide |
| SMILES | CCCOC1(C)C(C)=CC=CC1NC(=O)CC |
| InChI | InChI=1S/C14H23NO2/c1-5-10-17-14(4)11(3)8-7-9-12(14)15-13(16)6-2/h7-9,12H,5-6,10H2,1-4H3,(H,15,16) |
| InChIKey | HOHVRLRBOLMRDY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |