C15H19FNO3Y- — CID 59753079
[(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] acetate;yttrium (PubChem CID 59753079) has the molecular formula C15H19FNO3Y- and a molecular weight of 369.23 g/mol. Its IUPAC name is [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] acetate;yttrium.
| Compound Name | [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] acetate;yttrium |
|---|---|
| PubChem CID | 59753079 |
| Molecular Formula | C15H19FNO3Y- |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | [(1R,2S)-3-fluoro-2-(2-methylpropanoylamino)-1-phenylpropyl] acetate;yttrium |
| SMILES | CC(=O)O[C@H](c1cc[c-]cc1)[C@@H](CF)NC(=O)C(C)C.[Y] |
| InChI | InChI=1S/C15H19FNO3.Y/c1-10(2)15(19)17-13(9-16)14(20-11(3)18)12-7-5-4-6-8-12;/h5-8,10,13-14H,9H2,1-3H3,(H,17,19);/q-1;/t13-,14-;/m1./s1 |
| InChIKey | UASVKXOZDUOXSK-DTPOWOMPSA-N |
| XLogP | 2.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|