C12H17NO2 — CID 143588825
6-ethyl-2,2-dimethyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one (PubChem CID 143588825) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 6-ethyl-2,2-dimethyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-ethyl-2,2-dimethyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143588825 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 6-ethyl-2,2-dimethyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one |
| SMILES | CCC1=CC2NC(=O)C(C)(C)OC2C=C1 |
| InChI | InChI=1S/C12H17NO2/c1-4-8-5-6-10-9(7-8)13-11(14)12(2,3)15-10/h5-7,9-10H,4H2,1-3H3,(H,13,14) |
| InChIKey | XIYKYNOCRBXZAL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |