C14H17NO3 — CID 70046311
4-propyl-5,6a-dihydro-4aH-chromeno[4,3-b][1,4]oxazin-3-one (PubChem CID 70046311) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 4-propyl-5,6a-dihydro-4aH-chromeno[4,3-b][1,4]oxazin-3-one.
| Compound Name | 4-propyl-5,6a-dihydro-4aH-chromeno[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 70046311 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-propyl-5,6a-dihydro-4aH-chromeno[4,3-b][1,4]oxazin-3-one |
| SMILES | CCCN1C(=O)COC2=C3C=CC=CC3OCC21 |
| InChI | InChI=1S/C14H17NO3/c1-2-7-15-11-8-17-12-6-4-3-5-10(12)14(11)18-9-13(15)16/h3-6,11-12H,2,7-9H2,1H3 |
| InChIKey | NOCTWUFDQMTOQH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |