C35H57N7O2 — CID 142595451
1-[4-[7-(3-amino-2-methanimidoyl-6-methylphenyl)-2-(2-ethylheptoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one;ethane (PubChem CID 142595451) has the molecular formula C35H57N7O2 and a molecular weight of 607.89 g/mol. Its IUPAC name is 1-[4-[7-(3-amino-2-methanimidoyl-6-methylphenyl)-2-(2-ethylheptoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one;ethane.
| Compound Name | 1-[4-[7-(3-amino-2-methanimidoyl-6-methylphenyl)-2-(2-ethylheptoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 142595451 |
| Molecular Formula | C35H57N7O2 |
| Molecular Weight | 607.89 g/mol |
| Exact Mass | 607.46 |
| IUPAC Name | 1-[4-[7-(3-amino-2-methanimidoyl-6-methylphenyl)-2-(2-ethylheptoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one;ethane |
| SMILES | CC.CC.[H]/N=C/c1c(N)ccc(C)c1N1CCc2c(nc(OCC(CC)CCCCC)nc2N2CCN(C(=O)C=C)CC2)C1 |
| InChI | InChI=1S/C31H45N7O2.2C2H6/c1-5-8-9-10-23(6-2)21-40-31-34-27-20-38(29-22(4)11-12-26(33)25(29)19-32)14-13-24(27)30(35-31)37-17-15-36(16-18-37)28(39)7-3;2*1-2/h7,11-12,19,23,32H,3,5-6,8-10,13-18,20-21,33H2,1-2,4H3;2*1-2H3/b32-19+;; |
| InChIKey | SRTPDYGAUARCKH-PBFIREBQSA-N |
| XLogP | 6.80 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.89 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|