C16H23NO — CID 14259836
(E)-N-(2-methylbutyl)undec-2-en-8,10-diynamide (PubChem CID 14259836) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (E)-N-(2-methylbutyl)undec-2-en-8,10-diynamide.
| Compound Name | (E)-N-(2-methylbutyl)undec-2-en-8,10-diynamide |
|---|---|
| PubChem CID | 14259836 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (E)-N-(2-methylbutyl)undec-2-en-8,10-diynamide |
| SMILES | C#CC#CCCCC/C=C/C(=O)NCC(C)CC |
| InChI | InChI=1S/C16H23NO/c1-4-6-7-8-9-10-11-12-13-16(18)17-14-15(3)5-2/h1,12-13,15H,5,8-11,14H2,2-3H3,(H,17,18)/b13-12+ |
| InChIKey | GVXYCOGZGQWTFZ-OUKQBFOZSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|