C20H29NO — CID 14259841
(2E,9E)-N-(2-methylpropyl)hexadeca-2,9-dien-12,14-diynamide (PubChem CID 14259841) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (2E,9E)-N-(2-methylpropyl)hexadeca-2,9-dien-12,14-diynamide.
| Compound Name | (2E,9E)-N-(2-methylpropyl)hexadeca-2,9-dien-12,14-diynamide |
|---|---|
| PubChem CID | 14259841 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (2E,9E)-N-(2-methylpropyl)hexadeca-2,9-dien-12,14-diynamide |
| SMILES | CC#CC#CC/C=C/CCCCC/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C20H29NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)21-18-19(2)3/h9-10,16-17,19H,8,11-15,18H2,1-3H3,(H,21,22)/b10-9+,17-16+ |
| InChIKey | LSWADFLHCRYURF-JIXWLFTNSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|