C19H15N3O3 — CID 142598845
N-[3-(cyanomethyl)-1-ethenyl-3-hydroxy-2-oxoindol-5-yl]benzamide (PubChem CID 142598845) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is N-[3-(cyanomethyl)-1-ethenyl-3-hydroxy-2-oxoindol-5-yl]benzamide.
| Compound Name | N-[3-(cyanomethyl)-1-ethenyl-3-hydroxy-2-oxoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 142598845 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[3-(cyanomethyl)-1-ethenyl-3-hydroxy-2-oxoindol-5-yl]benzamide |
| SMILES | C=CN1C(=O)C(O)(CC#N)c2cc(NC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C19H15N3O3/c1-2-22-16-9-8-14(21-17(23)13-6-4-3-5-7-13)12-15(16)19(25,10-11-20)18(22)24/h2-9,12,25H,1,10H2,(H,21,23) |
| InChIKey | NDNVKGINYNNWNG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |