C19H15N3O4 — CID 142598912
[5-benzamido-3-(cyanomethyl)-2-oxo-1H-indol-3-yl] acetate (PubChem CID 142598912) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is [5-benzamido-3-(cyanomethyl)-2-oxo-1H-indol-3-yl] acetate.
| Compound Name | [5-benzamido-3-(cyanomethyl)-2-oxo-1H-indol-3-yl] acetate |
|---|---|
| PubChem CID | 142598912 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [5-benzamido-3-(cyanomethyl)-2-oxo-1H-indol-3-yl] acetate |
| SMILES | CC(=O)OC1(CC#N)C(=O)Nc2ccc(NC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C19H15N3O4/c1-12(23)26-19(9-10-20)15-11-14(7-8-16(15)22-18(19)25)21-17(24)13-5-3-2-4-6-13/h2-8,11H,9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | WWFUCVOEFMRMSY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |