C40H30N4O2 — CID 2835727
N-(3-benzamido-4b,9b-diphenyl-5,10-dihydroindolo[3,2-b]indol-8-yl)benzamide (PubChem CID 2835727) has the molecular formula C40H30N4O2 and a molecular weight of 598.71 g/mol. Its IUPAC name is N-(3-benzamido-4b,9b-diphenyl-5,10-dihydroindolo[3,2-b]indol-8-yl)benzamide.
| Compound Name | N-(3-benzamido-4b,9b-diphenyl-5,10-dihydroindolo[3,2-b]indol-8-yl)benzamide |
|---|---|
| PubChem CID | 2835727 |
| Molecular Formula | C40H30N4O2 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | N-(3-benzamido-4b,9b-diphenyl-5,10-dihydroindolo[3,2-b]indol-8-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C1(c3ccccc3)Nc3ccc(NC(=O)c4ccccc4)cc3C1(c1ccccc1)N2)c1ccccc1 |
| InChI | InChI=1S/C40H30N4O2/c45-37(27-13-5-1-6-14-27)41-31-21-23-35-33(25-31)39(29-17-9-3-10-18-29)40(43-35,30-19-11-4-12-20-30)34-26-32(22-24-36(34)44-39)42-38(46)28-15-7-2-8-16-28/h1-26,43-44H,(H,41,45)(H,42,46) |
| InChIKey | FNHCKZWSVIHVJY-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |