C40H26Cl4N4O2 — CID 3885852
2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4b,9b-diphenyl-5,10-dihydroindolo[3,2-b]indol-8-yl]benzamide (PubChem CID 3885852) has the molecular formula C40H26Cl4N4O2 and a molecular weight of 736.49 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4b,9b-diphenyl-5,10-dihydroindolo[3,2-b]indol-8-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4b,9b-diphenyl-5,10-dihydroindolo[3,2-b]indol-8-yl]benzamide |
|---|---|
| PubChem CID | 3885852 |
| Molecular Formula | C40H26Cl4N4O2 |
| Molecular Weight | 736.49 g/mol |
| Exact Mass | 734.08 |
| IUPAC Name | 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4b,9b-diphenyl-5,10-dihydroindolo[3,2-b]indol-8-yl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C1(c3ccccc3)Nc3ccc(NC(=O)c4ccc(Cl)cc4Cl)cc3C1(c1ccccc1)N2)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C40H26Cl4N4O2/c41-25-11-15-29(33(43)19-25)37(49)45-27-13-17-35-31(21-27)39(23-7-3-1-4-8-23)40(48-35,24-9-5-2-6-10-24)32-22-28(14-18-36(32)47-39)46-38(50)30-16-12-26(42)20-34(30)44/h1-22,47-48H,(H,45,49)(H,46,50) |
| InChIKey | BXVWLFJJLGLALZ-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.49 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |