C20H22O6 — CID 142600755
[3-hydroxy-2-(hydroxymethyl)oxan-4-yl] 4-phenylmethoxybenzoate (PubChem CID 142600755) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is [3-hydroxy-2-(hydroxymethyl)oxan-4-yl] 4-phenylmethoxybenzoate.
| Compound Name | [3-hydroxy-2-(hydroxymethyl)oxan-4-yl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 142600755 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [3-hydroxy-2-(hydroxymethyl)oxan-4-yl] 4-phenylmethoxybenzoate |
| SMILES | O=C(OC1CCOC(CO)C1O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O6/c21-12-18-19(22)17(10-11-24-18)26-20(23)15-6-8-16(9-7-15)25-13-14-4-2-1-3-5-14/h1-9,17-19,21-22H,10-13H2 |
| InChIKey | DJBOEPCQZLXTHJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |