C19H22F3N3OS — CID 142603119
(6R)-1-[2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 142603119) has the molecular formula C19H22F3N3OS and a molecular weight of 397.47 g/mol. Its IUPAC name is (6R)-1-[2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6R)-1-[2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 142603119 |
| Molecular Formula | C19H22F3N3OS |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (6R)-1-[2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Fc1ccc(F)c([C@H]2Cc3c(CCNC[C@@H]4CCCO4)[nH]c(=S)n3C2)c1F |
| InChI | InChI=1S/C19H22F3N3OS/c20-13-3-4-14(21)18(22)17(13)11-8-16-15(24-19(27)25(16)10-11)5-6-23-9-12-2-1-7-26-12/h3-4,11-12,23H,1-2,5-10H2,(H,24,27)/t11-,12-/m0/s1 |
| InChIKey | DKLLBMXNUOQJAQ-RYUDHWBXSA-N |
| XLogP | 3.61 |
| TPSA | 41.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|